Urumin

Urumin, a compound with antiviral properties, inhibits human influenza A virus growth, particularly the PR8 strain, with an inhibitory concentration (IC 50) of 3.8 μM. It acts by targeting the conserved stalk of H1 hemagglutinin and can neutralize drug-resistant H1 influenza viruses. Additionally, Urumin offers protective effects against lethal influenza infection in naive mice [1].

C([C@@H](C(N[C@H](C(N[C@H](C(N[C@H](C(N[C@H](C(N[C@@H](CC1=CN=CN1)C(N[C@H](C(N[C@@H](CC2=CC=CC=C2)C(N[C@H](C(N[C@H](C(NCC(N[C@H](C(N[C@H](C(N[C@H](C(N[C@H](C(N[C@H](C(O)=O)C)=O)CS)=O)C)=O)[C@H](CC)C)=O)C)=O)=O)CC(N)=O)=O)CO)=O)=O)CCCNC(=N)N)=O)=O)CS)=O)CCC(N)=O)=O)CO)=O)CC(O)=O)=O)NC([C@@H](NC(CNC([C@@H](NC([C@@H](NC([C@H](CC3=CC=CC=C3)NC([C@@H](NC(CNC([C@@H](NC([C@@H](NC(=O)[C@H]4N(C([C@H]([C@H](CC)C)N)=O)CCC4)CC(C)C)=O)CCCNC(=N)N)=O)=O)C)=O)=O)[C@H](CC)C)=O)CC(N)=O)=O)=O)CCCNC(=N)N)=O)C=5C=6C(NC5)=CC=CC6