Bis (DNS-glutathione) disulfide

Bis (DNS-glutathione) disulfide is a synthetic polypeptide composed of repeating α-L-glutamic acid units. Poly-DNS-glutathione is recognized for its biocompatibility, biodegradability, and non-immunogenic nature, making it highly suitable for advanced drug-delivery system engineering. Bis (DNS-glutathione) disulfide has been extensively employed in the creation of nanomaterials designed to improve drug loading, controlled release, and targeted biodistribution, ultimately supporting the development of safer and more efficient therapeutic delivery platforms.

S(N[C@@H](CCC(N[C@H](C(NCC(O)=O)=O)CSSC[C@H](NC(CC[C@H](NS(=O)(=O)C=1C2=C(C(N(C)C)=CC=C2)C=CC1)C(O)=O)=O)C(NCC(O)=O)=O)=O)C(O)=O)(=O)(=O)C=3C4=C(C(N(C)C)=CC=C4)C=CC3