α-Conotoxin S IA

α-Conotoxin SIA is a selective nicotinic acetylcholine receptor (nAChR) antagonist with high affinity for the muscle nAChR. α-Conotoxin SIA preferentially targets the α/δ interface of the muscle nAChR in mouse muscle. In contrast, for Torpedo nAChR, α-Conotoxin SIA has a much higher affinity for the α/γ than for the α/δ interface[1].

O=C1N2[C@@](C(N[C@H](C(N[C@]3([H])C(NCC(N[C@H](C(N[C@H](C(N[C@H](C(N[C@H](C(N[C@@H](CSSC[C@@](NC([C@H](CSSC3)NC([C@@H](N)CC4=CC=C(C=C4)O)=O)=O)([H])C(N[C@H]1CC5=CN=CN5)=O)C(N)=O)=O)CC(O)=O)=O)CC6=CC=CC=C6)=O)CC(N)=O)=O)CCCCN)=O)=O)=O)C)=O)([H])CCC2