PSMA-trillium

PSMA-trillium is a PSMA targeting compound, consisting of a PSMA targeting molecule (PSMA binder), a Macropa chelating molecule, and a group that regulates pharmacokinetics (PK modifier). PSMA-trillium is a non-radioactive form of Actinium-225-PSMA-Trillium (BAY 3563254) with improved PSMA targeting and pharmacokinetic properties. PSMA-trillium can bind Ac through the Macropa chelating molecule, or the radioactive isotope 225Actinium. Actinium-225-PSMA-Trillium is a potent inhibitor of metastatic castration-resistant prostate cancer (mCRPC)[1][2].

O=C(O)[C@H](CCC(O)=O)NC(N[C@@H](CCCCNC(NC1=CC(C2=CN(CCOCCOCCOCCC(N[C@@H](CCCCNC(NC3=CC=C(CCOC4=CC(C(O)=O)=[N]C(C[N]5CC[O]CC[O]CC[N](CC[O]CC[O]CC5)CC6=CC=CC(C(O)=O)=[N]6)=C4)C=C3)=S)C(NCCOCCOCCOCCOCCOCCOCCOCCOCCC(N[C@H](C(O)=O)CCCCNC(CCCC7=CC=C(I)C=C7)=O)=O)=O)=O)N=N2)=CC=C1)=O)C(O)=O)=O

[1]Zitzmann-Kolbe S, et al., Preclinical evaluation of an actinium-225 labeled PSMA-targeting small molecule (225Ac-PSMA-Trillium (BAY 3563254)) for the treatment of metastatic castration resistant prostate cancer (mCRPC)[J]. Cancer Research, 2024, 84(6_Supplement): 6033-6033.