diABZI-V/C-DBCO

diABZI-V/C-DBCO (Compound 3) is a potent STING agonist. diABZI-V/C-DBCO can release diABZI-amine upon activation by cathepsin B to activate STING, leading to the production of interferons and other immune-stimulatory molecules, thereby enhancing the immune system's response to tumors. The EC50 values for diABZI-V/C-DBCO and diABZI-amine in activating STING in THP1-Dual cells are 1.47 and 0.144 nM, respectively, and in primary mouse splenocytes, the EC50 values are 7.7 and 0.17 μM, respectively. diABZI-V/C-DBCO can be used in cancer immunotherapy research[1].

CCN1N=C(C=C1C(NC2=NC3=C(N2C/C=C/CN4C(NC(C5=CC(C)=NN5CC)=O)=NC6=CC(C(N)=O)=CC(OC)=C64)C(OCCCNC(OCC7=CC=C(C=C7)NC([C@@H](NC([C@H](C(C)C)NC(CCCCC(N8CC9=C(C=CC=C9)C#CC%10=C8C=CC=C%10)=O)=O)=O)CCCNC(N)=O)=O)=O)=CC(C(N)=O)=C3)=O)C