FeTCPP chloride

FeTCPP chloride (Iron (III) meso-Tetra (4-carboxyphenyl) porphine chloride) is a metalloporphyrin compound characterized by a central iron ion (Fe3+) coordinated with four 4-carboxyphenylporphine (TCPP) ligands. It serves as a catalyst in catalysis, electrochemical, photochemical, and biomedical research. Under visible light, FeTCPP chloride exhibits high photocatalytic efficiency towards p-nitrophenol. Additionally, it possesses peroxidase-like activity, making it useful in biomimetic catalysis studies.

O=C(C1=CC=C(C2=C3C=CC(C(C4=CC=C(C(O)=O)C=C4)=C5C=CC6=C7C8=CC=C(C(O)=O)C=C8)=[N]3[Fe+3]9([Cl-])([N-]56)[N-]%10C2=CC=C%10C(C%11=CC=C(C(O)=O)C=C%11)=C%12C=CC7=[N]9%12)C=C1)O