Succinyl-β-cycloaltrin

Succinyl-β-cycloaltrin is a modified cyclodextrin distinguished by unique chemical properties, enhancing its role as an effective solubilizing and stabilizing agent in various compounds, particularly within the pharmaceutical sector. With its hydrophobic interior and hydrophilic exterior, Succinyl-β-cycloaltrin forms stable inclusion complexes with hydrophobic molecules like drugs and nutrients. This interaction improves their solubility and bioavailability, making them more effective for therapeutic or nutritional applications.

O=C(CCC(C)=O)OC[C@@H](O[C@@](O[C@]([C@H]1O)([H])[C@H](O[C@@](O[C@]([C@H]2O)([H])[C@H](O[C@@](O[C@]([C@H]([C@@H]3O)O)([H])[C@H]4COC(CCC(O)=O)=O)([H])[C@H]2O)COC(CCC(O)=O)=O)([H])[C@H]1O)COC(CCC(O)=O)=O)([H])[C@H]5O)[C@@]([C@H]5O)([H])O[C@@]([C@H]([C@@H]6O)O)([H])O[C@@H]([C@@]6([H])O[C@@]([C@H]([C@@H]7O)O)([H])O[C@@H]([C@@]7([H])O[C@@]([C@H]([C@@H]8O)O)([H])O[C@@H]([C@@]8([H])O[C@@]3([H])O4)COC(CCC(O)=O)=O)COC(CCC(O)=O)=O)COC(CCC(O)=O)=O