DM-β-CD

DM-β-CD (2,6-Di-O-methyl-β-cyclodextrin) is a cyclic molecule composed of seven glucose units, modified with two methyl groups at the 2 and 6 positions. It is commonly utilized as a solubilizer and carrier for poorly soluble drugs in pharmaceutical formulations. Additionally, its ability to form inclusion complexes with various guest molecules—such as aromatic compounds, pesticides, and heavy metals—makes it valuable in analytical chemistry, food science, and environmental remediation.

COC[C@@H](O[C@@](O[C@]([C@@H]1O)([H])[C@H](O[C@@](O[C@]([C@@H]2O)([H])[C@H](O[C@@](O[C@]([C@@H]([C@H]3OC)O)([H])[C@H]4COC)([H])[C@@H]2OC)COC)([H])[C@@H]1OC)COC)([H])[C@@H]5OC)[C@](O[C@](O[C@@H]6COC)([H])[C@@H]([C@H]([C@]6([H])O[C@](O[C@@H]7COC)([H])[C@@H]([C@H]([C@]7([H])O[C@](O[C@@H]8COC)([H])[C@@H]([C@H]([C@]8([H])O[C@@]3([H])O4)O)OC)O)OC)O)OC)([H])[C@@H]5O