SP94

SP94 is a peptide ligand with high specificity for hepatocellular carcinoma cells. It selectively binds to various hepatocellular carcinoma cell lines in vitro. In mouse models of hepatocellular carcinoma, SP94 inhibits tumor growth by promoting tumor cell apoptosis (apoptosis) and reducing tumor angiogenesis. SP94 can serve as a specific probe for imaging hepatocellular carcinoma and is applicable in hepatocellular carcinoma research.

C([C@@H](NC([C@@H](NC(=O)[C@H]1N(C([C@@H](NC([C@H](CC2=CN=CN2)NC([C@@H](NC([C@@H](NC([C@@H](NC([C@H](CC3=CC=CC=C3)NC([C@H](CO)N)=O)=O)CO)=O)[C@H](CC)C)=O)[C@H](CC)C)=O)=O)[C@@H](C)O)=O)CCC1)[C@H](CC)C)=O)CC(C)C)(=O)N4[C@H](C(N[C@@H](CC(C)C)C(O)=O)=O)CCC4