Cys-PKHB1

Cys-PKHB1 (Cys-txCD47) is a polypeptide consisting of a cysteine (Cys) residue coupled with PKHB1, which is a CD47 agonist peptide that acts as a thrombospondin-1 peptide mimetic with anti-tumor properties. In breast cancer cells, PKHB1 induces mitochondrial changes, ROS production, intracellular Ca+ accumulation, and calcium-dependent cell death. Additionally, PKHB1 activates the immune system by inducing immunogenic cell death in breast cancer cells.

C([C@@H](C(N[C@H](C(N[C@H](CCCCN)C(O)=O)=O)CCCCN)=O)NC([C@@H](NC([C@@H](NC([C@@H](NC([C@H](CC1=CC=C(O)C=C1)NC([C@H](CC2=CC=CC=C2)NC([C@@H](NC([C@H](NC([C@H](CS)N)=O)CCCCN)=O)CCCNC(=N)N)=O)=O)=O)C(C)C)=O)[C@H](C)C)=O)CCSC)=O)C=3C=4C(NC3)=CC=CC4