Nef-M1

Immunology/Inflammation, GPCR/G Protein, Autophagy, Angiogenesis, Stem Cells, Apoptosis, PI3K/Akt/mTOR signaling, Proteases/Proteasome, Tyrosine Kinase/Adaptors, Cytoskeletal Signaling

Nef-M1 (Nef-Motif-1) is an antagonist peptide targeting CXCR4 and an apoptosis (apoptosis) inducer derived from the myristoylated protein encoded by the HIV nef gene. Nef-M1 inhibits tumor angiogenesis and epithelial-mesenchymal transition (EMT) by activating the apoptotic pathway through increased levels of caspase-3 in cancer cells. Additionally, it suppresses VEGF-A, p-GSK-3β, and vimentin while enhancing E-cadherin, thereby hindering angiogenesis and EMT processes. Nef-M1 is applicable in colorectal cancer and breast cancer research.

C([C@@H](C(N[C@H](C(N[C@H](C(N[C@H](C(N[C@@H](CCC(N)=O)C(O)=O)=O)C)=O)CCC(O)=O)=O)CC(C)C)=O)NC([C@@H](NC([C@@H](NC([C@@H](NC([C@@H](NC([C@@H](NC([C@H]([C@@H](C)O)N)=O)CC(N)=O)=O)C)=O)C)=O)CS)=O)C)=O)C=1C=2C(NC1)=CC=CC2