SjDX5-53

SjDX5-53 is a selective TLR2 inducer derived from a 3 kDa peptide found in Schistosoma japonicum eggs. This compound supports the production and inhibitory function of regulatory T cells (Tregs) by inducing tolerogenic dendritic cells (tolDCs), thereby suppressing inflammatory Th1 and Th17 responses. SjDX5-53 is primarily studied for its therapeutic potential in autoimmune and inflammatory conditions, such as colitis and psoriasis.

C([C@@H](NC([C@@H](NC([C@@H](NC([C@@H](NC([C@@H](NC([C@@H](NC([C@@H](NC(CN)=O)CCC(N)=O)=O)CCSC)=O)CCC(N)=O)=O)CCC(N)=O)=O)CCC(N)=O)=O)CCC(N)=O)=O)CCCNC(=N)N)(=O)N1[C@H](C(N[C@H](C(N[C@H](C(N[C@H](C(N[C@H](C(=O)N2[C@H](C(N[C@H](C(N[C@H](C(N[C@H](C(N[C@@H](CC3=CC=C(O)C=C3)C(N[C@H](C(N[C@H](C(N[C@H](C(N[C@H](C(N[C@H](C(N[C@H](C(N[C@H](C(N[C@H](C(N[C@@H](CCCNC(=N)N)C(O)=O)=O)CO)=O)CC(N)=O)=O)[C@@H](C)O)=O)CCSC)=O)CCC(N)=O)=O)CC(N)=O)=O)[C@@H](C)O)=O)C)=O)=O)CCC(N)=O)=O)CCC(N)=O)=O)CO)=O)CCC2)CCC(N)=O)=O)CCSC)=O)CCC(N)=O)=O)CCC(N)=O)=O)CCC1