PlCSA-BP

PlCSA-BP is a placental CSA-binding peptide that specifically binds to trophoblastic cells without interacting with other cell types in the placenta or with CSA-expressing cells in other tissues. It can direct nanoparticles to deliver payloads, such as Indocyanine green (ICG) and Methotrexate (MTX), for targeted placental drug delivery, highlighting its potential in placenta-specific drug delivery research.

[C@@H](CC1=CN=CN1)(NC([C@H](CC2=CC=CC=C2)NC([C@@H](NC([C@@H](NC([C@@H](NC([C@@H](NC([C@@H](NC(CNC([C@@H](NC([C@@H](NC([C@H](CC3=CC=CC=C3)NC([C@@H](NC([C@@H](NC([C@@H](NC([C@@H](NC([C@@H](NC([C@H](CC4=CC=CC=C4)NC([C@@H](NC([C@@H](NC([C@@H](NC([C@@H](NC([C@@H](NC([C@@H](NC([C@H](CCC(O)=O)N)=O)CC(O)=O)=O)[C@@H](C)C)=O)CCCCN)=O)CC(O)=O)=O)[C@H](CC)C)=O)CC(N)=O)=O)=O)CC(O)=O)=O)[C@@H](C)O)=O)CCCCN)=O)CCC(O)=O)=O)CCCCN)=O)=O)CC(C)C)=O)C)=O)=O)CS)=O)CC(C)C)=O)[C@H](CC)C)=O)C(C)C)=O)CO)=O)=O)C(N[C@H](C(NCC(N[C@H](C(N[C@H](C(O)=O)CS)=O)CCCCN)=O)=O)CCC(O)=O)=O