QPH-FR

QPH-FR is a quinoa peptide and acts as an inhibitor of the G protein-coupled receptor 5 (LGR5) that is abundant in leucine repeat sequences. By binding to LGR5, QPH-FR competitively inhibits the formation of the LGR5/RSPO1 complex. This interaction leads to the ubiquitination of FZD receptors by RNF43/ZNRF3, thereby inhibiting the Wnt/β-catenin signaling pathway and exerting stem cell suppression.

CC[C@H](C)[C@@H](C(=O)N[C@@H](CO)C(=O)N[C@@H](CCCNC(=N)N)C(=O)O)NC(=O)CNC(=O)CNC(=O)CNC(=O)CNC(=O)CNC(=O)CNC(=O)[C@@H]1CCCN1C(=O)[C@H](CCCNC(=N)N)NC(=O)[C@H](CO)NC(=O)[C@H](CC2=CNC3=CC=CC=C32)NC(=O)[C@H](C(C)C)NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CCC(=O)O)NC(=O)[C@H](CCCCN)NC(=O)[C@H](CC4=CC=CC=C4)N