CK3 peptide

CK3 peptide is an NRP-1-targeting peptide with the amino acid sequence CLKADKAKC. It specifically binds to NRP-1 to target breast cancer cells. Single-photon emission computed tomography (SPECT) and near-infrared fluorescence (NIRF) imaging demonstrate that CK3 peptide significantly accumulates in xenograft tumors in nude mice. CK3 peptide is applicable for molecular imaging studies of breast cancer.

C(CCCN)[C@@H]1NC(=O)[C@H](CC(O)=O)NC(=O)[C@H](C)NC(=O)[C@H](CCCCN)NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](N)CSSC[C@@H](C(O)=O)NC(=O)[C@H](CCCCN)NC(=O)[C@H](C)NC1=O