GPC3 targeting peptide 1

GPC3 targeting peptide 1 is a synthetic peptide ligand that binds to glypican-3 (GPC3) with a high affinity dissociation constant (Kd) of 0.23 nM. GPC3 targeting peptide 1 serves as a precise molecular probe for detecting and targeting GPC3-expressing tumor cells, particularly in hepatocellular carcinoma research, facilitating targeted imaging and therapeutic applications.

C(C1=CC2=C(C=C1)C=CN=C2)[C@@H]3N(C)C(=O)[C@H](CC4=CC=C(O)C=C4)NC(=O)[C@]([C@H](CC)C)(NC(=O)[C@]([C@H](CC)C)(NC(=O)[C@H](CC5=CC=C(C(O)=O)C=C5)NC(=O)[C@H](CCC(N)=O)N(C)C(=O)[C@H](CC(O)=O)NC(=O)[C@H](CCOC)N(C)C(=O)[C@H](CCCCN)N(C)C(=O)CSC[C@@H](C(N)=O)N(C)C(=O)[C@H](CC=6C=CC(=NC6)C7=CC=CC=C7)NC(=O)CNC3=O)[H])[H]