VH-N412

VH-N412 is a carrier-modified neurotrophin (NT) known for its excellent ability to penetrate the blood-brain barrier. This compound actively binds to both low-density lipoprotein receptor (LDLR) and neurotropin receptor 1 (NTSR-1), acting as an inducer of pharmacologically induced hypothermia (PIH) . Additionally, VH-N412 exhibits anticonvulsant and neuroprotective properties, making it a valuable agent for research in neurological disorders such as epilepsy.

C(N[C@@H](CC1=CC=C(O)C=C1)C(N[C@H](C(N[C@@H](CC(C)C)C(O)=O)=O)[C@H](CC)C)=O)(=O)[C@H]2N(C([C@@H](NC([C@@H](NC(CCOCCOCCOCCOCCOCCOCCNC(=O)[C@@H]3CSSC[C@@H](NC(CC)=O)C(=O)N[C@@H](CCSC)C(=O)N4[C@](C(=O)N[C@@H](CCCNC(=N)N)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCCNC(=N)N)C(=O)N(C)CC(=O)N3)(CCCC4)[H])=O)CCCNC(=N)N)=O)CCCNC(=N)N)=O)CCC2