Salusin-β

Salusin-β, an endogenous bioactive peptide, exhibits significant hemodynamic and mitotic activities. It can stimulate the proliferation of quiescent vascular smooth muscle cells (VSMCs) and fibroblasts, leading to a rapid and marked decrease in blood pressure and heart rate. Additionally, in rat models, Salusin-β stimulates the pituitary release of arginine vasopressin. This positions Salusin-β as a valuable compound in cardiovascular disease research.

C([C@H](NC([C@@H](NC([C@@H](NC([C@H](CC1=CC=CC=C1)NC([C@@H](NC([C@H](CC2=CC=CC=C2)NC([C@@H](NC([C@H](C)N)=O)[C@H](CC)C)=O)=O)[C@H](CC)C)=O)=O)[C@H](CC)C)=O)CCCNC(=N)N)=O)C(N[C@H](C(N[C@H](C(N[C@H](C(N[C@H](C(NCC(N[C@@H](CC3=CN=CN3)C(N[C@@H](CC4=CN=CN4)C(NCC(N[C@H](C(N[C@H](C(=O)N5[C@H](C(=O)N6[C@H](C(O)=O)CCC6)CCC5)C)=O)CCCNC(=N)N)=O)=O)=O)=O)=O)CC(C)C)=O)CCCCN)=O)CC(C)C)=O)CC(C)C)=O)C=7C=8C(NC7)=CC=CC8