Pantinin-1

Pantinin-1 is an antimicrobial peptide found in the venom of the emperor scorpion (Pandinus imperator) . This compound exhibits strong antibacterial activity against Gram-positive bacteria and fungi, but has weaker effects on Gram-negative bacteria. Additionally, Pantinin-1 demonstrates very low hemolytic activity on human red blood cells and possesses anticancer properties, specifically inducing apoptosis in tumor cells.

C([C@H](NC([C@@H](NC([C@@H](NC(CNC([C@@H](NC([C@@H](NC(CN)=O)[C@H](CC)C)=O)CC(C)C)=O)=O)CCCCN)=O)CC(C)C)=O)C(N[C@H](C(NCC(N[C@@H](CC1=CC=CC=C1)C(N[C@H](C(N[C@H](C(N[C@H](C(N[C@@H]([C@@H](C)C)C(O)=O)=O)[C@H](CC)C)=O)CO)=O)CCCCN)=O)=O)=O)CCC(O)=O)=O)C=2C=3C(NC2)=CC=CC3