Temporin SHF

Temporin SHF is an antimicrobial peptide with broad-spectrum antimicrobial activity against Gram-positive bacteria, Gram-negative bacteria and yeast, and is non-hemolytic. Its mechanism of action is to disrupt the accumulation of acyl chains in the anionic lipid bilayer of microorganisms, resulting in the formation and disintegration of microbial membrane cracks. This compound has application potential in antibacterial development.

[C@@H](CC1=CC=CC=C1)(NC([C@H](CC2=CC=CC=C2)NC([C@H](CC3=CC=CC=C3)N)=O)=O)C(N[C@H](C(N[C@H](C(N[C@H](C(N[C@H](C(N[C@@H](CC4=CC=CC=C4)C(N)=O)=O)[C@H](CC)C)=O)CCCNC(=N)N)=O)CO)=O)CC(C)C)=O