Tertiapin

Tertiapin (reduced) is a synthetic bee venom peptide characterized by disulfide bonds between Cys3-Cys14 and Cys5-Cys18. It acts as an inhibitor of inward-rectifying potassium channels (potassium Channel) and can also block the activity of calcium-activated large conductance potassium channels. Tertiapin (reduced) is utilized in research related to diseases such as rheumatoid arthritis and multiple sclerosis.

C([C@@H](C(N[C@H](C(N[C@H](C(N[C@H](C(NCC(N[C@H](C(N[C@@H](CCCCN)C(N)=O)=O)CCCCN)=O)=O)CS)=O)CCCCN)=O)CCCCN)=O)NC([C@@H](NC([C@@H](NC([C@@H](NC(=O)[C@H]1N(C([C@@H](NC([C@@H](NC([C@@H](NC([C@@H](NC([C@@H](NC([C@@H](NC([C@@H](NC([C@@H](NC([C@@H](NC([C@H](C)N)=O)CC(C)C)=O)CS)=O)CC(N)=O)=O)CS)=O)CC(N)=O)=O)CCCNC(=N)N)=O)[C@H](CC)C)=O)[C@H](CC)C)=O)[C@H](CC)C)=O)CCC1)CC2=CN=CN2)=O)CCSC)=O)CS)=O)C=3C=4C(NC3)=CC=CC4