TAT-PiET

TAT-PiET, a cell-penetrating peptide, targets the extra-terminal (ET) domain of BRD4, disrupting the critical BRD4/JMJD6 protein complex interaction necessary for oncogene expression in breast cancer. By inhibiting BRD4/JMJD6 target gene expression, TAT-PiET effectively suppresses breast cancer cell growth and confers resistance to endocrine therapy in ERα-positive breast cancer cells, marking it as a potential inhibitor of breast cancer.

[C@@H](CC1=CC=CC=C1)(NC([C@@H](NC([C@@H](NC([C@@H](NC([C@@H](NC([C@@H](NC([C@@H](NC([C@@H](NC([C@@H](NC([C@@H](NC([C@@H](NC([C@@H](NC([C@@H](NC([C@@H](NC(CNC([C@H](CC2=CC=C(O)C=C2)N)=O)=O)CCCNC(=N)N)=O)CCCCN)=O)CCCCN)=O)CCCNC(=N)N)=O)CCCNC(=N)N)=O)CCC(N)=O)=O)CCCNC(=N)N)=O)CCCNC(=N)N)=O)CCCNC(=N)N)=O)CCCNC(=N)N)=O)CC(N)=O)=O)CCC(N)=O)=O)CCCCN)=O)C(N[C@H](C(N[C@H](C(NCC(N[C@@H](CCC(O)=O)C(O)=O)=O)=O)CS)=O)CCCCN)=O