Neuropeptide W-30 (rat)

Neuropeptide W-30 (rat) acts as a crucial stress mediator within the central nervous system, influencing the hypothalamus-pituitary-adrenal (HPA) axis and sympathetic outflow. It serves as an endogenous ligand for the two related orphan G-protein-coupled receptors (GPCRs), GPR7 and GPR8. NPW-30 binds and activates both GPR7 and GPR8 at comparable effective doses [1] [2] [3].

C([C@H](NC([C@@H](NC([C@@H](NC(=O)[C@H]1N(C([C@@H](NC([C@@H](NC([C@@H](NC([C@@H](NC(CNC([C@@H](NC([C@@H](NC([C@@H](NC(CNC([C@@H](NC([C@@H](NC([C@@H](NC(CNC([C@@H](NC([C@@H](NC([C@H](CC2=CN=CN2)NC([C@H](CC3=CC=C(O)C=C3)NC([C@@H](NC(=O)[C@H]4N(C([C@@H](NC([C@@H](NC([C@@H](NC([C@H](CC5=CN=CN5)NC([C@@H](NC([C@H](CC6=CC=C(O)C=C6)NC([C@H](CC=7C=8C(NC7)=CC=CC8)N)=O)=O)CCCCN)=O)=O)C(C)C)=O)C)=O)CO)=O)CCC4)CCCNC(=N)N)=O)=O)=O)[C@@H](C)O)=O)[C@H](C)C)=O)=O)CCCNC(=N)N)=O)C)=O)CO)=O)=O)CC(C)C)=O)CC(C)C)=O)CCSC)=O)=O)CC(C)C)=O)CCCNC(=N)N)=O)CCCNC(=N)N)=O)CO)=O)CCC1)CC9=CC=C(O)C=C9)=O)CC(C)C)=O)C(O)=O)C=%10C=%11C(NC%10)=CC=CC%11