Immunoglobulin light chain variable region fragment [Homo sapiens]/[Mus musculus]

Immunoglobulin light chain variable region fragment [Homo sapiens]/[Mus musculus] is a fragment on the variable region of the human and mouse immunoglobulin light chain. Immunoglobulins (Ig) are the antigen recognition molecules of B cells. An Ig molecule is made up of 2 identical heavy chains and 2 identical light chains joined by disulfide bonds so that each heavy chain is linked to a light chain and the 2 heavy chains are linked together. On each of the light chains, there is one variable region and a constant region. The variable region is the most important for binding to antigens.

NC(CC(C)C)C(NC(CC(C)C)C(NC(C(C)CC)C(NC(CC1=CC=C(O)C=C1)C(NC(CC2=CNC3=C2C=CC=C3)C(NC(C)C(NC(CO)C(NC(C(O)C)C(NC(CCCNC(N)=N)C(O)=O)=O)=O)=O)=O)=O)=O)=O)=O