Protoescigenin 21-tiglate

Protoescigenin 21-tiglate (compound 10), a type of Bayberry Triterpenoid Saponin (BAT), can be isolated from the acidic hydrolyzed products (AHP) of a crude extract derived from bayberry seeds. BATs are generally known for their robust anti-tumor, anti-inflammatory, and anti-Alzheimer's activities. However, the anti-tumor activity of Protoescigenin 21-tiglate is relatively weak, with inhibitory concentrations (IC50) exceeding 80 μM for MCF-7 and at 80 μM for HeLa cells.

C(O)[C@]12[C@](C=3[C@@](C)(C[C@H]1O)[C@@]4(C)[C@](CC3)([C@]5(C)[C@@](CC4)([C@](CO)(C)[C@@H](O)CC5)[H])[H])(CC(C)(C)[C@@H](OC(/C(=C/C)/C)=O)[C@@H]2O)[H]