What is the catalog number for Tetramycin B?

The catalog number for Tetramycin B is TN7795.

What sizes are available for Tetramycin B?

Tetramycin B is available in the following size(s): 1 mg, 5 mg, 10 mg, 25 mg, 50 mg.

How many pack sizes does Tetramycin B come in?

Tetramycin B is available in 5 different pack sizes.

Is Tetramycin B in stock?

Tetramycin B is currently made to order / not held in immediate stock. Contact us for lead time.

Who manufactures Tetramycin B?

Tetramycin B is manufactured by Molfinity.

What is the estimated delivery time for Tetramycin B?

Estimated delivery time for Tetramycin B is approximately 10 business day(s), depending on your location.

Tetramycin B

Product Specifications

CAS Number

82517-08-6

Target

Antibiotic

Related Pathways

Microbiology/Virology

Purity

0.9509

Bioactivity

Tetramycin B (4-Hydroxytetramycin A), a polyene macrolide antibiotic and potent antifungal agent, is derived from Streptomyces hygrospinosus var. Beijingensis. Tetramycin B exhibits greater antifungal activity compared to Tetramycin A, primarily due to the critical role of its C-4 hydroxyl in enhancing its biological function.Tetramycin B is effective against various plant pathogenic fungi and has potential agricultural applications.

Smiles

O[C@@H]1[C@H](O[C@@H](C=C/C=C\C=C\C=C\[C@@H]([C@@H](C)O2)CC)C[C@@]3([H])[C@H](C(O)=O)[C@@H](O)C[C@@](O3)(O)C[C@@H](O)C[C@@H](O)[C@H](O)/C=C/C2=O)O[C@H](C)[C@@H](O)[C@@H]1N