Pyrogallol-phloroglucinol-6,6-bieckol

Pyrogallol-phloroglucinol-6,6-bieckol (PPB) is a bioactive phlorotannin compound isolated from the brown alga Ecklonia cava that exerts potent anti-inflammatory and anti-atherogenic activities by inhibiting monocyte migration and macrophage differentiation toward inflammatory phenotypes. Pyrogallol-phloroglucinol-6,6-bieckol reduces monocyte-induced endothelial cell death and suppresses vascular smooth muscle cell proliferation and migration, contributing to vascular protection and potential therapeutic modulation of inflammatory vascular diseases.

OC=1C=C(O)C=C(OC2=C(O)C=C(OC3=CC(O)=CC(OC4=C(O)C=C(O)C=5OC=6C(OC45)=C(O)C=C(O)C6C7=C(O)C=C(O)C=8OC=9C(OC=%10C=C(O)C=C(O)C%10)=C(O)C=C(O)C9OC87)=C3)C=C2O)C1