Betamethasone-d10 Dipropionate

Betamethasone-d10 Dipropionate is a deuterated compound of Betamethasone Dipropionate. Betamethasone Dipropionate has a CAS number of 5593-20-4. Betamethasone Dipropionate is the 17, 21-dipropionate ester of betamethasone, a synthetic glucocorticoid with metabolic, immunosuppressive and anti-inflammatory actions. Betamethasone dipropionate binds to specific intracellular glucocorticoid receptors and subsequently binds to DNA to modify gene expression. The synthesis of certain anti-inflammatory proteins is induced while the synthesis of certain inflammatory mediators is inhibited. As a result, there is an overall reduction in chronic inflammation and autoimmune reactions.

O=C(COC(=O)C(C([2H])([2H])[2H])([2H])[2H])[C@@]1(OC(=O)C(C([2H])([2H])[2H])([2H])[2H])[C@@H](C)C[C@]2([C@@]3(CCC4=CC(=O)C=C[C@]4(C)[C@@]3(F)[C@@H](O)C[C@]12C)[H])[H]