Tauroursodeoxycholic-d4 Acid

Tauroursodeoxycholic-d4 Acid is a deuterated compound of Tauroursodeoxycholic Acid. Tauroursodeoxycholic Acid has a CAS number of 14605-22-2. Tauroursodeoxycholate, also known as ursodoxicoltaurine, is a highly hydrophilic tertiary bile acid that is produced in humans at a low concentration. Tauroursodeoxycholate is the more hydrophilic form of ursodeoxycholic acid, which is the more abundant naturally produced bile acid in humans.Tauroursodeoxycholate is being investigated for use in several conditions such as Primary Biliary Cirrhosis (PBC), insulin resistance, amyloidosis, Cystic Fibrosis, Cholestasis, and Amyotrophic Lateral Sclerosis.

C[C@@]([H])([C@]1([H])[C@@]2([C@]([H])([C@]3([H])[C@@]([H])(O)C[C@@]4([H])[C@@]([C@@]3([H])CC2)(CC([2H])([2H])[C@@H](O)C4([2H])[2H])C)CC1)C)CCC(=O)NCCS(=O)(=O)O