PROTAC SMARCA2/4-degrader-18

PROTAC SMARCA2/4-degrader-18 (Compound I-348) is a PROTAC degrader targeting the catalytic subunits SMARCA2 and SMARCA4 of the SWI/SNF complex. It effectively degrades SMARCA2 in A549 cells with a DC50 value of less than 100 nM and similarly degrades SMARCA4 in MV411 cells, also with a DC50 of less than 100 nM.

NC1=C(N2CC3N(C(C2)CC3)C=4N=CC(=CN4)C5CCN(CC6=CC=C(C(N[C@H](C(=O)N7[C@H](C(NCC8=CC=C(C=C8)C9=C(C)N=CS9)=O)C[C@@H](O)C7)[C@](C)(C)C)=O)C=C6)CC5)C=C(N=N1)C%10=C(O)C=CC=C%10