Muscle homing peptide M12

Muscle homing peptide M12 preferentially binds to proteins on the surface of muscle cells. It enhances the cellular uptake of nanoparticles (NPs) in myoblasts. Additionally, Muscle homing peptide M12 is covalently attached to PLGA-PEG nanoparticles through an N-hydroxysuccinimide ester reaction, with the bonding occurring at the α-amino group at the N-terminus of the peptide chain.

C(=O)([C@H]1N(C([C@@H](NC([C@@H](NC([C@H](CCCNC(=N)N)N)=O)CCCNC(=N)N)=O)CCC(N)=O)=O)CCC1)N2[C@H](C(N[C@H](C(N[C@H](C(N[C@H](C(N[C@H](C(N[C@H](C(N[C@H](C(=O)N3[C@H](C(O)=O)CCC3)CC4=CN=CN4)=O)CO)=O)CO)=O)[C@H](CC)C)=O)CO)=O)CCCNC(=N)N)=O)CCC2