TPP-Ce6

TPP-Ce6 is a mitochondria-targeting photosensitizer formed by the ester linkage of chlorin e6 (Ce6) with triphenylphosphine (TPP) . Upon light exposure, TPP-Ce6 generates reactive oxygen species (ROS), particularly singlet oxygen, which induce oxidative stress, leading to mitochondrial dysfunction and apoptosis (cellular apoptosis) . This compound is useful for research on mitochondrial roles in apoptosis, energy metabolism, and cancer treatment.

[P+](CCOC(=O)C1=C2C(CC(OCC[P+](C3=CC=CC=C3)(C4=CC=CC=C4)C5=CC=CC=C5)=O)=C6[C@@H](CCC(OCC[P+](C7=CC=CC=C7)(C8=CC=CC=C8)C9=CC=CC=C9)=O)[C@H](C)C(=N6)C=C%10NC(=CC%11=NC(=CC(=C1C)N2)C(CC)=C%11C)C(C=C)=C%10C)(C%12=CC=CC=C%12)(C%13=CC=CC=C%13)C%14=CC=CC=C%14