Solvent orange 62

Solvent Orange 62 is a multifunctional dye used in biological experiments to observe and analyze cell structures, track biomolecules, evaluate cell functions, distinguish cell types, detect biomolecules, study tissue pathology, and monitor microorganisms. Its applications extend from basic scientific research to clinical diagnostics. Additionally, dyes are widely utilized in traditional fields like textile dyeing and emerging areas such as functional textile processing, food pigments, and dye-sensitized solar cells.

CC([C-]12)=NN(C3=CC=CC=C3)C2=O[Cr+3]456([N]([C-]7C(N(C8=CC=CC=C8)N=C7C)=O6)=NC9=CC([N+]([O-])=O)=CC=C9[O-]5)[N]1=NC%10=CC([N+]([O-])=O)=CC=C%10[O-]4.[H+]