Tri-GalNAc-PEG3-Azide

Tri-GalNAc-PEG3-Azide is a specialized compound designed for lysosomal targeting chimera (LYTAC) research, featuring three asialoglycoprotein receptor (ASGPR) ligands linked by a PEG3 spacer and an azide group for easy conjugation. This compound facilitates efficient internalization into hepatocytes through ASGPR-mediated endocytosis, making it a strategic tool for delivering RNA, Cas9 complexes, or other cargo specifically to liver cells. Additionally, it can be utilized to create LYTACs or to be marked with a dye for tissue imaging applications.

OC[C@H]([C@@H]([C@@H]([C@H]1NC(C)=O)O)O)O[C@H]1OCCCCC(NCCCNC(CCOCC(COCCC(NCCCNC(CCCCO[C@@H]2O[C@@H]([C@@H]([C@@H]([C@H]2NC(C)=O)O)O)CO)=O)=O)(COCCC(NCCCNC(CCCCO[C@@H]3O[C@@H]([C@@H]([C@@H]([C@H]3NC(C)=O)O)O)CO)=O)=O)NC(CCOCCOCCOCCN=[N+]=[N-])=O)=O)=O