Brain Natriuretic Peptide-32 (rat) acetate

Brain natriuretic peptide-32 (BNP-32), a fragment of the proBNP cardiovascular hormone precursor, exhibits affinity for natriuretic peptide receptors in rat vascular smooth muscle cells (IC50 = 7.3 nM) and promotes cGMP accumulation within these cells (EC50 = 170 nM) . Additionally, BNP-32 effectively mediates the relaxation of norepinephrine-precontracted isolated rat aortic strips (EC50 = 6.7 nM) . Upon administration at a dosage of 3 μg/kg, it elevates urine and urinary electrolyte outputs and induces hypotension in rats.

O=C(N[C@@H](CO)C(N[C@@H](CCCCN)C(N[C@@H](CCSC)C(N[C@H](C(N[C@@H](CC1=CNC=N1)C(N[C@@H](CO)C(N[C@@H](CO)C(N[C@@H](CO)C(N[C@@H](CSSC[C@H](N2)C(N[C@@H](CC(O)=O)C(NCC(N[C@H](C(N[C@@H](CCC/N=C(N)/N)C(N[C@H](C(N[C@H](C(O)=O)CC3=CC=CC=C3)=O)CC(C)C)=O)=O)CC(C)C)=O)=O)=O)C(N[C@H](C(NCC(N[C@@H](CCC(N)=O)C(N[C@@H](CCCCN)C(N[C@@](C(N[C@@H](CC(O)=O)C(N[C@@H](CCC/N=C(N)/N)C(N[C@@](C(NCC(N[C@H](C(N[C@@H](C(C)C)C(N[C@@H](CO)C(N[C@@H](CCC/N=C(N)/N)C(N[C@H](C(NCC2=O)=O)CC(C)C)=O)=O)=O)=O)C)=O)=O)([H])[C@@H](C)CC)=O)=O)=O)([H])[C@@H](C)CC)=O)=O)=O)=O)CC4=CC=CC=C4)=O)=O)=O)=O)=O)=O)C)=O)=O)=O)[C@H](CC(N)=O)N[H].CC(O)=O