S1H TFA

S1H, a synthetic peptide mimetic of human growth hormone amino acids 36-51, acts as an antagonist to the growth hormone receptor. It forms an α-helical structure in solution and inhibits STAT5 phosphorylation triggered by human growth hormone in SK-MEL-28 and MALME-3M melanoma cell lines, as well as prolactin in IM-9 B cell lymphocytes, at concentrations of 100 and 200 nM.

NC([C@@]([C@@H](C)O)([H])NC([C@H](CCC(N)=O)NC([C@@H]1CCCN1C([C@H](CC(N)=O)NC([C@H](CCC(N)=O)NC([C@H](CC(C)C)NC([C@@H](NC([C@H](CO)NC([C@@H](NC([C@H](CCCCN)NC([C@H](CCC(N)=O)NC([C@H](CCC(O)=O)NC([C@H](CCCCN)NC([C@@H]2CCCN2C([C@@]([C@H](CC)C)([H])NC([C@@H](NC(C)=O)CC3=CC=C(O)C=C3)=O)=O)=O)=O)=O)=O)=O)CC4=CC=C(O)C=C4)=O)=O)CC5=CC=CC=C5)=O)=O)=O)=O)=O)=O)=O.OC(C(F)(F)F)=O