TIP39 (human, bovine) TFA

TIP39, a neuropeptide and an agonist for the parathyroid hormone receptor type 2 (PTH2R), effectively increases cAMP levels in COS-7 cells featuring recombinant PTH2R from humans or rats (EC50s = 0.5 and 0.8 nM, respectively), as well as in F-11 cells that naturally express PTH2R (EC50 = 1.15 nM) . Furthermore, TIP39 at 1 nM halts the cell cycle at the G0/G1 phase and reduces Sox9 expression, a crucial regulator of cartilage differentiation, in CFK2 rat chondrocytes. Additionally, administering 100 pmol/animal of TIP39 reduces the immobility period in the forced swim test in mice, indicating a potential antidepressant effect.

OC(C(F)(F)F)=O.O=C(N[C@H](C(N[C@H](C(N[C@H](C(N[C@H](C(N[C@@H](CC(O)=O)C(N[C@@H](CC(O)=O)C(N[C@H](C(N[C@H](C(N[C@H](C(N[C@@H](CCCNC(N)=N)C(N[C@@H](CCC(O)=O)C(N[C@@H](CCCNC(N)=N)C(N[C@H](C(N[C@@H](CCCNC(N)=N)C(N[C@H](C(N[C@H](C(N[C@H](C(N[C@H](C(N[C@H](C(N[C@@H](CCC(O)=O)C(N[C@@H](CCCNC(N)=N)C(N[C@@H](CCCNC(N)=N)C(N[C@@H](CC1=CNC=N1)C(N[C@@H](CC2=CNC3=C2C=CC=C3)C(N[C@H](C(N[C@@H](CC(N)=O)C(N[C@@H](CO)C(N[C@@H](CC4=CC=C(O)C=C4)C(N[C@@H](CCSC)C(N[C@@H](CC5=CNC=N5)C(N[C@@H](CCCCN[H])C(N[C@H](C(N[C@H](C(N[C@@H](C(C)C)C(N[C@H](C(N[C@@H](CC(O)=O)C(N[C@H](C(N6CCC[C@H]6C(O)=O)=O)C)=O)=O)CC(C)C)=O)=O)CC(C)C)=O)CC(C)C)=O)=O)=O)=O)=O)=O)=O)CC(C)C)=O)=O)=O)=O)=O)=O)CC(C)C)=O)C)=O)C)=O)CC(C)C)=O)CC(C)C)=O)=O)C)=O)=O)=O)=O)CC7=CC=CC=C7)=O)C)=O)C)=O)=O)=O)C)=O)CC(C)C)=O)C)=O)CC(C)C)[C@H](CO)N[H]