TRPV1-Tat TFA

TRPV1-Tat, a peptide antagonist targeting transient receptor potential vanilloid 1 (TRPV1), is composed of amino acids 736-745 derived from TRPV1's A-kinase anchor protein (AKAP) -binding domain, combined with the HIV Tat-derived cell-penetrating peptide sequence. At a concentration of 200 μM, TRPV1-Tat effectively inhibits heat or phorbol 12-myristate 13-acetate (PMA014) -induced currents in primary mouse dorsal root ganglia via whole-cell patch-clamp assays. Additionally, when administered at dosages of 10 or 30 μM, it elevates the mechanical pain threshold in the hind paws of rats.

OC(C(F)(F)F)=O.O=C(N[C@@H](CC(O)=O)C(N[C@@H](CC(O)=O)C(N[C@@H](CC1=CC=C(O)C=C1)C(N[C@@H](CCCNC(N)=N)C(N[C@@H](CC2=CNC3=C2C=CC=C3)C(N[C@@H](CS[H])C(N[C@H](C(N[C@@H](CCCNC(N)=N)C(N[C@@H](C(C)C)C(N[C@@H](CC4=CC=C(O)C=C4)C(NCC(N[C@@H](CCCNC(N)=N)C(N[C@@H](CCCCN[H])C(N[C@@H](CCCCN[H])C(N[C@@H](CCCNC(N)=N)C(N[C@@H](CCCNC(N)=N)C(N[C@@H](CCC(N)=O)C(N[C@@H](CCCNC(N)=N)C(N[C@@H](CCCNC(N)=N)C(N[C@@H](CCCNC(N)=N)C(O)=O)=O)=O)=O)=O)=O)=O)=O)=O)=O)=O)=O)=O)=O)CC5=CC=CC=C5)=O)=O)=O)=O)=O)=O)[C@H](CCCCN[H])N[H]