Magainin 2 TFA

Magainin 2, a cationic peptide derived from the African clawed frog (X. laevis) skin, exhibits host defense and antimicrobial properties. This compound effectively inhibits a range of pathogens, including E. coli, K. pneumoniae, S. epidermidis, S. aureus bacteria, and C. albicans fungus, with minimum inhibitory concentrations (MICs) of 5, 10, 10, 50, and 80 μg/ml, respectively. Additionally, at a concentration of 20 μM, Magainin 2 significantly reduces the germination and tube elongation in kiwi fruit pollen. It also curtails viral replication in Vero cells infected by herpes simplex virus 1 (HSV-1) or HSV-2, with half-maximal effective concentrations (EC50s) of 22.16 and 19.8 μM, respectively, while demonstrating low toxicity to these cells, shown by a 50% cytotoxic concentration (CC50) greater than 100 μM.

O=C(N[C@@](C(NCC(N[C@@H](CCCCN[H])C(N[C@H](C(N[C@H](C(N[C@@H](CC1=CNC=N1)C(N[C@@H](CO)C(N[C@H](C(N[C@@H](CCCCN[H])C(N[C@@H](CCCCN[H])C(N[C@H](C(NCC(N[C@@H](CCCCN[H])C(N[C@H](C(N[C@H](C(N[C@@H](C(C)C)C(NCC(N[C@@H](CCC(O)=O)C(N[C@@](C(N[C@@H](CCSC)C(N[C@@H](CC(N)=O)C(N[C@@H](CO)C(O)=O)=O)=O)=O)([H])[C@@H](C)CC)=O)=O)=O)=O)CC2=CC=CC=C2)=O)C)=O)=O)=O)CC3=CC=CC=C3)=O)=O)=O)C)=O)=O)=O)CC(C)C)=O)CC4=CC=CC=C4)=O)=O)=O)([H])[C@@H](C)CC)CN[H].OC(C(F)(F)F)=O