Alloferon 1

Alloferon 1, a peptide derived from the blood of the blow fly Calliphora vicina (Diptera) [1] [2] [3], exhibits antiviral and antitumoral properties. It activates natural cytotoxicity of human peripheral blood lymphocytes, induces IFN synthesis, and enhances resistance against viral and tumor challenges in mice. Additionally, Alloferon 1 demonstrates anti-inflammatory effects in λ-carrageenan-induced paw edema models.

[C@@H](CC1=CN=CN1)(NC([C@@H](NC(CNC([C@H](CC2=CN=CN2)NC(CNC([C@@H](NC([C@@H](NC(CNC([C@H](CC3=CN=CN3)N)=O)=O)[C@@H](C)C)=O)CO)=O)=O)=O)=O)CCC(N)=O)=O)C(NCC(N[C@H](C(N[C@@H](CC4=CN=CN4)C(NCC(O)=O)=O)=O)[C@@H](C)C)=O)=O