What is the catalog number for Safflor yellow B?

The catalog number for Safflor yellow B is T81229.

What sizes are available for Safflor yellow B?

Safflor yellow B is available in the following size(s): 5 mg, 50 mg.

How many pack sizes does Safflor yellow B come in?

Safflor yellow B is available in 2 different pack sizes.

Is Safflor yellow B in stock?

Safflor yellow B is currently made to order / not held in immediate stock. Contact us for lead time.

Who manufactures Safflor yellow B?

Safflor yellow B is manufactured by Molfinity.

What is the estimated delivery time for Safflor yellow B?

Estimated delivery time for Safflor yellow B is approximately 10 business day(s), depending on your location.

Safflor yellow B

Product Specifications

CAS Number

91574-92-4

Bioactivity

Safflor Yellow B mitigates angiotensin II-induced injury in human umbilical vein cells by modulating Bcl-2/p22 (phox) expression and demonstrates neuroprotective effects [1].

Smiles

O=C(C=CC1=CC=C(O)C=C1)C=2C(=O)C(=C(O)C(O)(C2O)C3OC(CO)C(O)C(O)C3O)C(C=4C(=O)C(C(=O)C=CC5=CC=C(O)C=C5)=C(O)C(O)(C4O)C6OC(CO)C(O)C(O)C6O)C(O)C(O)C(O)C(O)CO