SN38-PAB-Lys (MMT) -oxydiacetamide-PEG8-N3

"SN38-PAB-Lys (MMT) -oxydiacetamide-PEG8-N3 is a drug-linker conjugate for antibody-drug conjugates (ADCs), consisting of the anti-cancer agent SN38 linked to Lys (MMT) -PAB-oxydiacetamide-PEG8-N3. It serves as a click chemistry reagent featuring an azide group that participates in copper-catalyzed azide-alkyne cycloaddition (CuAAC) with alkyne-bearing molecules and can also engage in strain-promoted alkyne-azide cycloaddition (SPAAC) with compounds containing DBCO or BCN groups, facilitating the synthesis of ADCs [1]."

C(NCCCC[C@@H](C(NC1=CC=C(COC(O[C@@]2(CC)C3=C(C(=O)N4C(=C3)C=5C(C4)=C(CC)C=6C(N5)=CC=C(O)C6)COC2=O)=O)C=C1)=O)NC(COCC(NCCOCCOCCOCCOCCOCCOCCOCCOCCN=[N+]=[N-])=O)=O)(C7=CC=C(OC)C=C7)(C8=CC=CC=C8)C9=CC=CC=C9