What is the catalog number for Dynorphin B (1-9)?

The catalog number for Dynorphin B (1-9) is T80463.

What sizes are available for Dynorphin B (1-9)?

Dynorphin B (1-9) is available in the following size(s): 5 mg, 50 mg.

How many pack sizes does Dynorphin B (1-9) come in?

Dynorphin B (1-9) is available in 2 different pack sizes.

Is Dynorphin B (1-9) in stock?

Dynorphin B (1-9) is currently made to order / not held in immediate stock. Contact us for lead time.

Who manufactures Dynorphin B (1-9)?

Dynorphin B (1-9) is manufactured by Molfinity.

What is the estimated delivery time for Dynorphin B (1-9)?

Estimated delivery time for Dynorphin B (1-9) is approximately 10 business day(s), depending on your location.

Dynorphin B (1-9)

Product Specifications

CAS Number

126050-26-8

Target

Opioid Receptor

Related Pathways

Endocrinology/Hormones, GPCR/G Protein, Neuroscience

Bioactivity

Dynorphin B (1-9), a neuropeptide and the N-terminal cleavage product of dynorphin B, has its formation inhibited by N-ethylmaleimide (NEM), a non-selective cysteine peptidase inhibitor [1].

Smiles

[C@H](CC1=CC=CC=C1)(C(N[C@H](C(N[C@H](C(N[C@H](C(N[C@H](C(N[C@@H](CC2=CC=CC=C2)C(O)=O)=O)CCC(N)=O)=O)CCCNC(=N)N)=O)CCCNC(=N)N)=O)CC(C)C)=O)NC(CNC(CNC([C@H](CC3=CC=C(O)C=C3)N)=O)=O)=O