What is the catalog number for Calpastatin subdomain B?

The catalog number for Calpastatin subdomain B is T80241.

What sizes are available for Calpastatin subdomain B?

Calpastatin subdomain B is available in the following size(s): 5 mg, 50 mg.

How many pack sizes does Calpastatin subdomain B come in?

Calpastatin subdomain B is available in 2 different pack sizes.

Is Calpastatin subdomain B in stock?

Calpastatin subdomain B is currently made to order / not held in immediate stock. Contact us for lead time.

Who manufactures Calpastatin subdomain B?

Calpastatin subdomain B is manufactured by Molfinity.

What is the estimated delivery time for Calpastatin subdomain B?

Estimated delivery time for Calpastatin subdomain B is approximately 10 business day(s), depending on your location.

Calpastatin subdomain B

Product Specifications

CAS Number

128578-18-7

Target

Proteasome

Related Pathways

Proteases/Proteasome, Ubiquitination

Bioactivity

Calpastatin subdomain B is a bioactive peptide that inhibits calpain activity.

Smiles

C(=O)([C@H]1N(C([C@@H](NC([C@@H](NC([C@@H](NC([C@@H](NC([C@@H](NC([C@@H](NC(CNC([C@@H](NC([C@@H](NC([C@@H](NC([C@@H](NC([C@H](CC2=CC=C(O)C=C2)NC([C@@H](NC([C@@H](NC([C@@H](NC([C@@H](NC(=O)[C@H]3N(C([C@H](CC(O)=O)N)=O)CCC3)CCSC)=O)CO)=O)CO)=O)[C@@H](C)O)=O)=O)[C@H](CC)C)=O)CCC(O)=O)=O)CCC(O)=O)=O)CC(C)C)=O)=O)CCCCN)=O)CCCNC(=N)N)=O)CCC(O)=O)=O)[C@@H](C)C)=O)[C@@H](C)O)=O)[C@H](CC)C)=O)CCC1)N4[C@H](C(N[C@H](C(N[C@@H](CC5=CC=C(O)C=C5)C(N[C@H](C(N[C@H](C(N[C@H](C(N[C@H](C(N[C@H](C(O)=O)C)=O)CC(C)C)=O)CC(C)C)=O)CCC(O)=O)=O)CCCNC(=N)N)=O)=O)CCCCN)=O)CCC4