α-Conotoxin TxID

α-Conotoxin TxID is a potent antagonist of the α3β4 nicotinic acetylcholine receptor (nAChR) with an inhibitory half-maximal inhibitory concentration (IC50) of 12.5 nM. Its inhibitory activity is weaker against the closely related α6/α3β4 nAChR, with an IC50 of 94 nM. This compound holds potential for the development of novel smoking cessation drugs [1].

O=C1N2[C@](C(=O)N[C@@H]([C@@H](C)C)C(=O)N[C@@]3(C(=O)N[C@@H](CO)C(=O)N[C@@H](C)C(=O)N[C@@H](CCSC)C(=O)N[C@@H](CO)C(=O)N4[C@](C(=O)N[C@@]([C@H](CC)C)(C(=O)N[C@H](C(N)=O)CSSC[C@@](C(=O)N[C@@H](CO)C(=O)N[C@H]1CC5=CN=CN5)(NC(=O)[C@@H](NC(CN)=O)CSSC3)[H])[H])(CCC4)[H])[H])(CCC2)[H]