LQVTDSGLYRCVIYHPP

LQVTDSGLYRCVIYHPP (LP17) is a peptide and TREM-1 (Triggering Receptor Expressed on Myeloid cells 1) inhibitor derived from a highly conserved sequence between the extracellular structural domains of mouse and human TREM-1 and TLT-1.LP17 inhibits TREM-1 activation through a decoy receptor LP17 inhibits TREM-1 activation by actin through a decoy receptor mechanism, which has the advantage of penetrating the brain barrier and attenuating neuronal damage and inflammatory responses.

C(=O)([C@H]1N(C([C@H](CC2=CN=CN2)NC([C@H](CC3=CC=C(O)C=C3)NC([C@@H](NC([C@@H](NC([C@@H](NC([C@@H](NC([C@H](CC4=CC=C(O)C=C4)NC([C@@H](NC(CNC([C@@H](NC([C@@H](NC([C@@H](NC([C@@H](NC([C@@H](NC([C@H](CC(C)C)N)=O)CCC(N)=O)=O)C(C)C)=O)[C@@H](C)O)=O)CC(O)=O)=O)CO)=O)=O)CC(C)C)=O)=O)CCCNC(=N)N)=O)CS)=O)[C@H](C)C)=O)[C@H](CC)C)=O)=O)=O)CCC1)N5[C@H](C(O)=O)CCC5