Neuropeptide AF (cattle)

Neuropeptide AF (cattle), an amidated octadecapeptide and RFamide neuropeptide, serves as a ligand for Mas-related gene receptor A4 (MrgprA4) (Mas-related G-protein-coupled Receptor (MRGPR) ) with an EC50 of approximately 60 nM, and MrgprC11 with an EC50 of around 300 nM. It activates G protein-coupled receptors NPFF1 (Neuropeptide Y Receptor) with an EC50 ranging from ~25 to 325 nM, and NPFF2 with an EC50 of approximately 1 to 5 nM. Additionally, Neuropeptide AF (cattle) exhibits anti-opiate effects and modulates related pain [1] [2].

CC(C)C[C@H](NC(=O)CNC(=O)[C@H](CCC(O)=O)NC(=O)CNC(=O)[C@H](C)N)C(=O)N[C@@H](CO)C(=O)N[C@@H](CO)C(=O)N1CCC[C@H]1C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)N[C@@H](CO)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](C)C(=O)N[C@@H](C)C(=O)N1CCC[C@H]1C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@@H](Cc1ccccc1)C(N)=O