RGD-4C

RGD-4C, an arginine-glycine-aspartic acid peptide (ACDCRGDCFC), exhibits integrin binding activity. The primary integrin recognition site in extracellular matrix proteins, the Arg-Gly-Asp (RGD) sequence, allows peptides with this sequence to mimic matrix proteins' recognition specificity. As an αv-integrin ligand, RGD-4C can be conjugated with bioactive molecules to demonstrate antitumor effects in animal models [1] [2] [3].

[H][C@]12CSSC[C@]([H])(NC(=O)[C@H](CC(O)=O)NC(=O)CNC(=O)[C@H](CCCNC(N)=N)NC1=O)C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@@H](CSSC[C@H](NC(=O)[C@H](C)N)C(=O)N[C@@H](CC(O)=O)C(=O)N2)C(=O)NCC(O)=O