Demoxytocin

Demoxytocin, an analog of oxytocin and a heterodetic cyclic peptide, enhances cell membrane permeability to elevate calcium ion levels in smooth muscle cells, thereby augmenting contraction, including the smooth muscles of the uterus. This compound mirrors oxytocin's function and is utilized in studies focusing on labor induction following premature rupture [1].

C(=O)(N1[C@H](C(N[C@H](C(NCC(N)=O)=O)CC(C)C)=O)CCC1)[C@H]2NC(=O)[C@H](CC(N)=O)NC(=O)[C@H](CCC(N)=O)NC(=O)[C@]([C@H](CC)C)(NC(=O)[C@H](CC3=CC=C(O)C=C3)NC(=O)CCSSC2)[H]