β-Glucuronide-dPBD-PEG5-NH2

β-Glucuronide-dPBD-PEG5-NH2 is a β-glucuronide-linked pyrrolobenzodiazepine dimer that functions as a proagent for the synthesis of the antibody-drug conjugate (ADC) cIRCR201-dPBD, utilizing a cleavable β-glucuronide linkage. This compound targets and binds to the prenylated antibody, facilitating controlled drug release to mitigate side effects and exhibits antitumor properties by inducing apoptosis and arresting the cell cycle [1].

[H][C@@]12CC(=C)CN1C(=O)c1cc(OC)c(OCCCCCOc3cc4N(C(O)[C@]5([H])CC(=C)CN5C(=O)c4cc3OC)C(=O)OCc3ccc(O[C@@H]4O[C@@H]([C@@H](O)[C@H](O)[C@H]4O)C(O)=O)c(c3)C(=O)NCCOCCOCCOCCOCCOCCON)cc1N(C2O)C(=O)OCc1ccc(O[C@@H]2O[C@@H]([C@@H](O)[C@H](O)[C@H]2O)C(O)=O)c(c1)C(=O)NCCOC